2-AMINO-1-METHYL-6-PHENYLIMIDAZO[4,5-B]PYRIDINE manufacturers
- PhIP
-
- $48.00 / 1mg
-
2026-02-03
- CAS:105650-23-5
- Min. Order:
- Purity: 99.96%
- Supply Ability: 10g
|
| | 2-AMINO-1-METHYL-6-PHENYLIMIDAZO[4,5-B]PYRIDINE Basic information |
| | 2-AMINO-1-METHYL-6-PHENYLIMIDAZO[4,5-B]PYRIDINE Chemical Properties |
| Melting point | 300 | | Boiling point | 355.66°C (rough estimate) | | density | 1.2067 (rough estimate) | | refractive index | 1.5890 (estimate) | | storage temp. | Refrigerator | | solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml; Ethanol: 15 mg/ml; Ethanol:PBS (pH 7.2) (1:3): 0.25 mg/ml | | pka | 7.72±0.30(Predicted) | | form | A crystalline solid | | color | White to light yellow | | biological source | synthetic | | InChI | 1S/C13H12N4/c1-17-11-7-10(9-5-3-2-4-6-9)8-15-12(11)16-13(17)14/h2-8H,1H3,(H2,14,15,16) | | InChIKey | UQVKZNNCIHJZLS-UHFFFAOYSA-N | | SMILES | NC1=NC2=NC=C(C3=CC=CC=C3)C=C2N1C | | CAS DataBase Reference | 105650-23-5(CAS DataBase Reference) | | IARC | 2B (Vol. 56) 1993 |
| Hazard Codes | T | | WGK Germany | WGK 3 | | Hazard Note | Toxic | | HS Code | 29333999 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Hazardous Substances Data | 105650-23-5(Hazardous Substances Data) |
| | 2-AMINO-1-METHYL-6-PHENYLIMIDAZO[4,5-B]PYRIDINE Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Carcinogen | | Definition | ChEBI: An imidazopyridine that is 1H--imidazo[4,5-b]pyridine which is substituted at positions 1, 2, and 6 by methyl, amino, and phenyl groups, respectively. It is the most abundant of the mutagenic heterocyclic amines found in coo
ed meat and fish. | | Biological Activity | Carcinogen developed in grilled meats. Induces breast and colon cancer in rats. | | Safety Profile | Confirmed carcinogen with experimental carcinogenic data. Mutation data reported. When heated to decomposition it emits toxic vapors of NOx,. | | Carcinogenicity | PhIP is reasonably anticipated to be a human carcinogen based on sufficient evidence of carcinogenicity from studies in experimental animals and supporting genotoxicity data. |
| | 2-AMINO-1-METHYL-6-PHENYLIMIDAZO[4,5-B]PYRIDINE Preparation Products And Raw materials |
|