| Company Name: |
Zhengzhou Haochuang New Material Co., Ltd. Gold
|
| Tel: |
19139721821; 19139721821 |
| Email: |
3545426645@qq.com |
| Products Intro: |
Product Name:4,4'-(1,10-Phenanthroline-2,9-diyl)dianiline
CAS:861659-70-3
Purity:98% Package:25g 50g 100g 250g 500g
|
4,4'-(1,10-phenanthroline-2,9-diyl)dianiline manufacturers
|
| | 4,4'-(1,10-phenanthroline-2,9-diyl)dianiline Basic information |
| Product Name: | 4,4'-(1,10-phenanthroline-2,9-diyl)dianiline | | Synonyms: | 4,4'-(1,10-phenanthroline-2,9-diyl)dianiline;Benzenamine, 4,4'-(1,10-phenanthroline-2,9-diyl)bis-;4,4 '- (1,10-phenanthroline-2,9-diyl) diphenylamine | | CAS: | 861659-70-3 | | MF: | C24H18N4 | | MW: | 362.43 | | EINECS: | | | Product Categories: | | | Mol File: | 861659-70-3.mol |  |
| | 4,4'-(1,10-phenanthroline-2,9-diyl)dianiline Chemical Properties |
| Boiling point | 633.7±50.0 °C(Predicted) | | density | 1.297±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 5.82±0.30(Predicted) | | Appearance | Yellow to orange Solid | | InChI | InChI=1S/C24H18N4/c25-19-9-3-15(4-10-19)21-13-7-17-1-2-18-8-14-22(28-24(18)23(17)27-21)16-5-11-20(26)12-6-16/h1-14H,25-26H2 | | InChIKey | QWVPZNAGYLSYEH-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=C(C2=CC=C(N)C=C2)C=C3)C=CC=1C1=CC=C(N)C=C1 |
| | 4,4'-(1,10-phenanthroline-2,9-diyl)dianiline Usage And Synthesis |
| | 4,4'-(1,10-phenanthroline-2,9-diyl)dianiline Preparation Products And Raw materials |
|