| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | SULFO-NHS-LC-LC-BIOTIN Basic information |
| Product Name: | SULFO-NHS-LC-LC-BIOTIN | | Synonyms: | SULFO-NHS-LC-LC-BIOTIN;6-[[6-[[5-[(3aS,4S,6aR)-Hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]amino]-1-oxohexyl]amino]-hexanoic acid 2,5-dioxo-3-sulfo-1-pyrrolidinyl ester sodium salt;EZ-Link Sulfo-NHS-LC-LC-Biotin;F 6347;FluoReporter Biotin-XX;Sulfo-NHS-XX-Biotin;Biotin-XX, SSE [6-((6-((Biotinoyl)aMino)hexanoyl)aMino)hexanoic acid, sulfosucciniMidyl ester, sodiuM salt];PLZQFLFWCXFJDQ-BJPAGVOZSA-M | | CAS: | 194041-66-2 | | MF: | C26H40N5NaO10S2 | | MW: | 669.74307 | | EINECS: | | | Product Categories: | | | Mol File: | 194041-66-2.mol |  |
| | SULFO-NHS-LC-LC-BIOTIN Chemical Properties |
| storage temp. | -20-0°C | | form | solid | | InChIKey | RWNPTJCDHAXLGI-BJPAGVOZSA-N | | SMILES | [Na].O=C1NC2CSC(CCCCC(=O)NCCCCCC(=O)NCCCCCC(=O)ON3C(=O)CC(C3=O)S(=O)(=O)O)C2N1 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | SULFO-NHS-LC-LC-BIOTIN Usage And Synthesis |
| Uses | Amine-Reactive Water soluble form of Biotin |
| | SULFO-NHS-LC-LC-BIOTIN Preparation Products And Raw materials |
|