| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Hexanoic-6,6,6-d3 acid Basic information |
| Product Name: | Hexanoic-6,6,6-d3 acid | | Synonyms: | HEXANOIC ACID (METHYL-D3);HEXANOIC ACID-6,6,6-D3;CAPROIC ACID-6,6,6-D3;CAPROIC ACID (METHYL-D3);HEXANOIC-6,6,6-D3 ACID, 99 ATOM % D;Hexanoic--d3 Acid;Hexanoic Acid-d3;Hexanoic acid-6,6,6-d? | | CAS: | 55320-69-9 | | MF: | C6H9D3O2 | | MW: | 119.18 | | EINECS: | | | Product Categories: | | | Mol File: | 55320-69-9.mol |  |
| | Hexanoic-6,6,6-d3 acid Chemical Properties |
| Melting point | -3 °C(lit.) | | Boiling point | 202-203 °C(lit.) | | density | 0.951 g/mL at 25 °C | | refractive index | n20/D 1.412(lit.) | | Fp | 220 °F | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml | | form | An oil | | pka | 4.781±0.10(predicted) | | color | Colorless to light yellow | | InChI | 1S/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8)/i1D3 | | InChIKey | FUZZWVXGSFPDMH-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])CCCCC(O)=O | | CAS Number Unlabeled | 142-62-1 |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 23-26-27-36/37/39-45 | | RIDADR | UN 2829 8/PG 3 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1C |
| | Hexanoic-6,6,6-d3 acid Usage And Synthesis |
| Uses | Hexanoic-6,6,6-d3 Acid is the labeled analogue of 1-Hexanoic Acid (H292145), a colorless oily liquid with an odor that is fatty, cheesy, waxy, and like that of goats. Its esters can be used as artificial flavors. It is also one of the components of vanilla. |
| | Hexanoic-6,6,6-d3 acid Preparation Products And Raw materials |
|