| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Benzyloxy-3-chlorophenylboronic acid manufacturers
|
| | 4-Benzyloxy-3-chlorophenylboronic acid Basic information |
| | 4-Benzyloxy-3-chlorophenylboronic acid Chemical Properties |
| Melting point | 188-193 °C (lit.) | | Boiling point | 450.2±55.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 7.67±0.17(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C13H12BClO3/c15-12-8-11(14(16)17)6-7-13(12)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2 | | InChIKey | AYSMMNDQVZAXQY-UHFFFAOYSA-N | | SMILES | OB(O)c1ccc(OCc2ccccc2)c(Cl)c1 | | CAS DataBase Reference | 845551-44-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29310095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Benzyloxy-3-chlorophenylboronic acid Usage And Synthesis |
| | 4-Benzyloxy-3-chlorophenylboronic acid Preparation Products And Raw materials |
|