|
|
| | 2-(Chloromethyl)benzoic acid Basic information |
| Product Name: | 2-(Chloromethyl)benzoic acid | | Synonyms: | RARECHEM AL BO 1528;2-(CHLOROMETHYL)BENZOIC ACID;2-(Chloromethyl)benzoic acid >=97.0% (GC);o-Chloromethylbenzoic acid;2-(Chloromethyl)benzoic acid 99%;Benzoic acid, 2-(chloromethyl)-;Tranexamic Acid Impurity 16;α-Chloro-o-toluic acid | | CAS: | 85888-81-9 | | MF: | C8H7ClO2 | | MW: | 170.59 | | EINECS: | | | Product Categories: | Organic acids | | Mol File: | 85888-81-9.mol |  |
| | 2-(Chloromethyl)benzoic acid Chemical Properties |
| Melting point | 135-135.5 °C | | Boiling point | 305.7±17.0 °C(Predicted) | | density | 1.315±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 3.73±0.36(Predicted) | | form | crystalline needles | | color | Colourless to white crystals | | BRN | 1940772 | | InChI | InChI=1S/C8H7ClO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2,(H,10,11) | | InChIKey | YTEUDCIEJDRJTM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1CCl | | CAS DataBase Reference | 85888-81-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3261 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 2916399090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Skin Corr. 1B |
| | 2-(Chloromethyl)benzoic acid Usage And Synthesis |
| Uses | 2-Chloromethylbenzoic Acid acts as a reagent for the synthesis of (azolyl)methyl)arylbenzamides as dual inhibitors of VEGFR-1/2 kinases. |
| | 2-(Chloromethyl)benzoic acid Preparation Products And Raw materials |
|