|
|
| | 4-(4-Phenoxy-phenyl)-thiazol-2-ylamine Basic information |
| | 4-(4-Phenoxy-phenyl)-thiazol-2-ylamine Chemical Properties |
| Melting point | 117 °C(Solv: ethanol (64-17-5)) | | Boiling point | 456.2±28.0 °C(Predicted) | | density | 1.276±0.06 g/cm3(Predicted) | | pka | 4.33±0.10(Predicted) | | form | solid | | InChI | 1S/C15H12N2OS/c16-15-17-14(10-19-15)11-6-8-13(9-7-11)18-12-4-2-1-3-5-12/h1-10H,(H2,16,17) | | InChIKey | AZZJNMYKYSAYPZ-UHFFFAOYSA-N | | SMILES | NC1=NC(C(C=C2)=CC=C2OC3=CC=CC=C3)=CS1 |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-(4-Phenoxy-phenyl)-thiazol-2-ylamine Usage And Synthesis |
| | 4-(4-Phenoxy-phenyl)-thiazol-2-ylamine Preparation Products And Raw materials |
|