|
|
| | 3,5-Pyrazoledicarboxylic acid monohydrate Basic information | | Form Structure |
| Product Name: | 3,5-Pyrazoledicarboxylic acid monohydrate | | Synonyms: | 3,5-PYRAZOLEDICARBOXYLIC ACID MONOHYDRATE;LABOTEST-BB LT00455359;TIMTEC-BB SBB003804;1H-Pyrazole-3,5-dicarboxylic acid monohydrate, 98%;1H-Pyrazole-3,5-dicarboxylic acid, hydrate;3,5-Pyrazoledicarboxylic acid monohydrate 97%;Pyrazole-3,5-dicarboxylic acid monohydrate for synthesis;1H-Pyrazole-3,5-dicarboxylic acid, hydrate (1:1) | | CAS: | 303180-11-2 | | MF: | C5H6N2O5 | | MW: | 174.11 | | EINECS: | 221-474-7 | | Product Categories: | C3 to C5;Building Blocks;Chemical Synthesis;Heterocyclic Building Blocks;Pyrazoles | | Mol File: | 303180-11-2.mol |  |
| | 3,5-Pyrazoledicarboxylic acid monohydrate Chemical Properties |
| Melting point | 292-295 °C (dec.)(lit.) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | BRN | 147821 | | InChI | InChI=1S/C5H4N2O4.H2O/c8-4(9)2-1-3(5(10)11)7-6-2;/h1H,(H,6,7)(H,8,9)(H,10,11);1H2 | | InChIKey | GLINCONFUZIMCN-UHFFFAOYSA-N | | SMILES | C1(C(=O)O)=NNC(C(=O)O)=C1.O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3,5-Pyrazoledicarboxylic acid monohydrate Usage And Synthesis |
| Form | Solid | | Structure |
In the 3,5-Pyrazoledicarboxylic acid monohydrate, C5H4N2O4·H2O, the 3,5-pyrazoledicarboxylic acid (H3pdc) molecules are joined into one-dimensional chains by O-H···O and N-H···O hydrogen bonds, with distances of 2.671 (2) and 2.776 (2) A, respectively. The one-dimensional chains form a three-dimensional structure via O-H···OW and OW-HW···N hydrogen bonds, with distances of 2.597 (3) and 2.780 (3) A, respectively. In addition to the potential for forming open-channel frameworks, access to the six coordination atoms of H3pdc can be directly controlled by varying the pH of the reaction environment, allowing further control over the design and synthesis of novel coordination polymers using various metal centres.
In addition to the potential for forming open-channel frameworks, access to the six coordination atoms of H3pdc can be directly controlled by varying the pH of the reaction environment, allowing further control over the design and synthesis of novel coordination polymers using various metal centres. H3pdc possesses three different protonated hydrogens: Ha, Hb, and Hc. Although both Ha and Hb are attached to carboxylic oxygen atoms, the two experience quite different coordination environments. Hc in this ligand is linked to a nitrogen atom and is more difficult to deprotonate than the other two hydrogen atoms. The difference in the binding power of these protons allows their deprotonation at different pH levels. The flexible, multifunctional coordination sites of this ligand also give a high likelihood for generating coordination polymers with high dimensions[1-2].
| | Uses | 3,5-PYRAZOLEDICARBOXYLIC ACID MONOHYDRATE is a useful research chemical. | | References |
[1] Ching. “3,5-Pyrazoledicarboxylic acid monohydrate.” Acta crystallographica. Section C, Crystal structure communications 56 (Pt 9) (2000): 1124–5. [2] Irena Kostova, Wolfgang Kiefer, Niculina Peica. “Raman, FT-IR, and DFT studies of 3,5-pyrazoledicarboxylic acid and its Ce(III) and Nd(III) complexes.” Journal of Raman Spectroscopy 38 1 (2006): 1–10.
|
| | 3,5-Pyrazoledicarboxylic acid monohydrate Preparation Products And Raw materials |
|