|
|
| | (S)-(+)-2-Oxo-4-phenyl-3-oxazolidineacetic acid Basic information |
| | (S)-(+)-2-Oxo-4-phenyl-3-oxazolidineacetic acid Chemical Properties |
| Melting point | 103-105 °C(lit.) | | Boiling point | 516.4±50.0 °C(Predicted) | | density | 1.351 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.00±0.10(Predicted) | | Optical Rotation | [α]28/D +165°, c = 2 in chloroform | | InChI | 1S/C11H11NO4/c13-10(14)6-12-9(7-16-11(12)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14)/t9-/m1/s1 | | InChIKey | PUKMRNJLFMISMT-SECBINFHSA-N | | SMILES | OC(=O)CN1[C@H](COC1=O)c2ccccc2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (S)-(+)-2-Oxo-4-phenyl-3-oxazolidineacetic acid Usage And Synthesis |
| Uses | The chiral ketene derived from this product leads to chiral β-lactams via the Staudinger reaction. This strategy has been extended to prepare unnatural dipeptides. |
| | (S)-(+)-2-Oxo-4-phenyl-3-oxazolidineacetic acid Preparation Products And Raw materials |
|