| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine
CAS:62596-64-9
Purity:98% Package:1G,5G
|
| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:(S)-1-[(4-Methylphenyl)sulfonyl]-2-(phenylmethyl)aziridine
CAS:62596-64-9
Purity:95%/98% Package:1G;100G;1KG Remarks:135190
|
| Company Name: |
Shanghai Aladdin Bio-Chem Technology Co.,LTD
|
| Tel: |
400-6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:(S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine
CAS:62596-64-9
Purity:98% Package:1g/RMB 830.90;5g/RMB 3099.90
|
| Company Name: |
Taizhou Tongxin Bio-Tech Co., Ltd
|
| Tel: |
0523-86818997 18652728585 |
| Email: |
sales@allyrise.com |
| Products Intro: |
Product Name:(S)-2-Benzyl-1-tosylaziridine
CAS:62596-64-9
Purity:98% Package:1g;10g;100g
|
|
| | (S)-(+)-2-BENZYL-1-(P-TOLYLSULFONYL)AZIRIDINE Basic information |
| Product Name: | (S)-(+)-2-BENZYL-1-(P-TOLYLSULFONYL)AZIRIDINE | | Synonyms: | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine 98%;(S)-1-[(4-Methylphenyl)sulfonyl]-2-(phenylmethyl)aziridi
ne,99%e.e.;(S)-(+)-2-BENZYL-1-(P-TOLYLSULFONYL)AZIRIDINE;Aziridine, 1-[(4-Methylphenyl)sulfonyl]-2-(phenylMethyl)-, (2S)-;S-1-[(4-Methylphenyl)sulfonyl]-2-(phenylMethyl)-Aziridine;(2S)-1-[(4-methylphenyl)sulfonyl]-2-
(phenylmethyl)-Aziridine;(S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine;(S)-(+)-2-Benzy-1-(P-Tolylsulfonyl)Aziridine | | CAS: | 62596-64-9 | | MF: | C16H17NO2S | | MW: | 287.38 | | EINECS: | | | Product Categories: | Aziridines;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 62596-64-9.mol |  |
| | (S)-(+)-2-BENZYL-1-(P-TOLYLSULFONYL)AZIRIDINE Chemical Properties |
| Melting point | 92-94 °C(lit.) | | Optical Rotation | [α]20/D +8.8°, c = 1.3 in toluene | | InChI | 1S/C16H17NO2S/c1-13-7-9-16(10-8-13)20(18,19)17-12-15(17)11-14-5-3-2-4-6-14/h2-10,15H,11-12H2,1H3/t15-,17?/m0/s1 | | InChIKey | ISURUORMAKCTFF-MYJWUSKBSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)N2C[C@@H]2Cc3ccccc3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (S)-(+)-2-BENZYL-1-(P-TOLYLSULFONYL)AZIRIDINE Usage And Synthesis |
| Uses | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine can be used:
- To prepare tert-butyl(S)-6-((4-methylphenyl)sulfonamido)-3-oxo-7-phenylheptanoate, an intermediate for the synthesis of substituted octahydroindoles.
- In the preparation of ortho-bromo phenethylamine products, which are further used to synthesize chiral 2-substituted indolines.
- In the synthesis of β-aryltelluro?amines as potent carbonic anhydrase inhibitors.
|
| | (S)-(+)-2-BENZYL-1-(P-TOLYLSULFONYL)AZIRIDINE Preparation Products And Raw materials |
|