| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine Basic information |
| Product Name: | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine | | Synonyms: | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine 98%;(S)-1-[(4-Methylphenyl)sulfonyl]-2-(phenylmethyl)aziridi
ne,99%e.e.;Aziridine, 1-[(4-Methylphenyl)sulfonyl]-2-(phenylMethyl)-, (2S)-;S-1-[(4-Methylphenyl)sulfonyl]-2-(phenylMethyl)-Aziridine;(2S)-1-[(4-methylphenyl)sulfonyl]-2-
(phenylmethyl)-Aziridine;(S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine;(S)-(+)-2-Benzy-1-(P-Tolylsulfonyl)Aziridine;(S)-2-Benzyl-1-tosylaziridine | | CAS: | 62596-64-9 | | MF: | C16H17NO2S | | MW: | 287.38 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Organic Building Blocks;Aziridines | | Mol File: | 62596-64-9.mol |  |
| | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine Chemical Properties |
| Melting point | 92-94 °C(lit.) | | Optical Rotation | [α]20/D +8.8°, c = 1.3 in toluene | | InChI | 1S/C16H17NO2S/c1-13-7-9-16(10-8-13)20(18,19)17-12-15(17)11-14-5-3-2-4-6-14/h2-10,15H,11-12H2,1H3/t15-,17/m0/s1 | | InChIKey | ISURUORMAKCTFF-MYJWUSKBSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)N2C[C@@H]2Cc3ccccc3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine Usage And Synthesis |
| Uses | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine can be used:
- To prepare tert-butyl(S)-6-((4-methylphenyl)sulfonamido)-3-oxo-7-phenylheptanoate, an intermediate for the synthesis of substituted octahydroindoles.
- In the preparation of ortho-bromo phenethylamine products, which are further used to synthesize chiral 2-substituted indolines.
- In the synthesis of β-aryltelluroamines as potent carbonic anhydrase inhibitors.
|
| | (S)-(+)-2-Benzyl-1-(p-tolylsulfonyl)aziridine Preparation Products And Raw materials |
|