|
|
| | (S)-3-AMINO-1-CBZ-PYRROLIDINE Basic information |
| Product Name: | (S)-3-AMINO-1-CBZ-PYRROLIDINE | | Synonyms: | (S)-BENZYL-3-AMINOPYRROLIDINE-1-CARBOXYLATE;(S)-1-BENZYLOXYCARBONYL-3-AMINOPYRROLIDINE;(S)-(+)-1-CBZ-3-AMINOPYRROLIDINE;(S)-3-AMINO-1-CBZ-PYRROLIDINE;(S)-3-Amino-1-N-Cbz-pyrrolidine;(S)-3-AMino-1-N-cbz-pyrrolidine HCl;(S)-(+)-3-AMino-1-(benzyloxycarbonyl)pyrrolidine, 96%;(S)-(+)-1-Cbz-3-aminopyrrolidine 97% | | CAS: | 122536-72-5 | | MF: | C12H16N2O2 | | MW: | 220.27 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 122536-72-5.mol |  |
| | (S)-3-AMINO-1-CBZ-PYRROLIDINE Chemical Properties |
| Melting point | 310-316℃ | | Boiling point | 315 °C | | density | 1.155 g/mL at 25 °C | | refractive index | n20/D 1.548 | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | pka | 9.52±0.20(Predicted) | | Appearance | Light yellow to yellow Liquid | | Sensitive | Air Sensitive | | InChI | 1S/C12H16N2O2/c13-11-6-7-14(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,11H,6-9,13H2/t11-/m0/s1 | | InChIKey | FPXJNSKAXZNWMQ-NSHDSACASA-N | | SMILES | N[C@H]1CCN(C1)C(=O)OCc2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 12 - Non Combustible Liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (S)-3-AMINO-1-CBZ-PYRROLIDINE Usage And Synthesis |
| | (S)-3-AMINO-1-CBZ-PYRROLIDINE Preparation Products And Raw materials |
|