| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,6-Dichloro-2-(trifluoromethyl)quinoline Basic information | | Uses |
| Product Name: | 4,6-Dichloro-2-(trifluoromethyl)quinoline | | Synonyms: | BUTTPARK 147\04-12;4,6-Dichloro-2-(trifluoromethyl)quinoline 97%;4,6-Dichloro-2-(trifluoromethyl)quinoline97%;Quinoline, 4,6-dichloro-2-(trifluoromethyl)-;Quinoline, 4,6-dichloro-2-(trifluoromethyl)-4,6-dichloro-2-(trifluoromethyl)quinoline;4,6-DICHLORO-2-(TRIFLUOROMETHYL)QUINOLINE;4-Hydroxy-7-bromoquinoline-2-carboxylic acid | | CAS: | 18706-33-7 | | MF: | C10H4Cl2F3N | | MW: | 266.05 | | EINECS: | | | Product Categories: | | | Mol File: | 18706-33-7.mol |  |
| | 4,6-Dichloro-2-(trifluoromethyl)quinoline Chemical Properties |
| Melting point | 104-107°C | | Boiling point | 262.9±35.0 °C(Predicted) | | density | 1.527±0.06 g/cm3(Predicted) | | pka | -2.02±0.50(Predicted) | | InChI | InChI=1S/C10H4Cl2F3N/c11-5-1-2-8-6(3-5)7(12)4-9(16-8)10(13,14)15/h1-4H | | InChIKey | HYBXFYJUELGZOC-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(Cl)=CC=2)C(Cl)=CC=1C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | Hazard Note | Irritant | | HS Code | 2933499090 |
| | 4,6-Dichloro-2-(trifluoromethyl)quinoline Usage And Synthesis |
| Uses |
4,6-Dichloro-2-(trifluoromethyl)quinoline is used as a laboratory chemicals and manufacture of substances.
| | Synthesis | Starting from 2-trifluoromethyl-4-hydroxy-6-chloroquinoline, chlorine atoms can be introduced at the 4- and 6-positions by a chlorinating agent (POCl₃ or SOCl₂) to obtain 4,6-Dichloro-2-(trifluoromethyl)quinoline. It can also be prepared by cyclizing aniline derivatives with trifluoroacetoacetate through the Conrad–Limpach reaction and then chlorinating. |
| | 4,6-Dichloro-2-(trifluoromethyl)quinoline Preparation Products And Raw materials |
|