|
|
| | Triethoxysilylpropylethylcarbamate Basic information |
| Product Name: | Triethoxysilylpropylethylcarbamate | | Synonyms: | [3-(triethoxysilyl)propyl]-carbamicaciethylester;Carbamicacid,[3-(triethoxysilyl)propyl]-,ethylester;N-[3-(Triethoxysilyl)propyl]carbamic acid ethyl ester;triethoxysilylpropylethylcarbaMe;ETHYL 3-(TRIETHOXYSILYL)PROPYLCARBAMATE;(3-(TRIETHOXYSILYL)PROPYL)-CARBAMICACID,ETHYLESTER;Carbamic acid, N-[3-(triethoxysilyl)propyl]-, ethyl ester;Ethyl[3-(triethoxysllW)propylcarbamate | | CAS: | 17945-05-0 | | MF: | C12H27NO5Si | | MW: | 293.43 | | EINECS: | 241-872-4 | | Product Categories: | | | Mol File: | 17945-05-0.mol |  |
| | Triethoxysilylpropylethylcarbamate Chemical Properties |
| Melting point | <0°C | | Boiling point | 124 °C | | density | 1.015 | | vapor pressure | 6-18.3hPa at 20-50℃ | | refractive index | 1.4321 | | Fp | 95°C | | pka | 12.84±0.46(Predicted) | | form | Liquid | | Specific Gravity | 1.015 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C12H27NO5Si/c1-5-15-12(14)13-10-9-11-19(16-6-2,17-7-3)18-8-4/h5-11H2,1-4H3,(H,13,14) | | InChIKey | MVUXVDIFQSGECB-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)NCCC[Si](OCC)(OCC)OCC | | EPA Substance Registry System | Ethyl (3-triethoxysilyl)propylcarbamate (17945-05-0) |
| | Triethoxysilylpropylethylcarbamate Usage And Synthesis |
| | Triethoxysilylpropylethylcarbamate Preparation Products And Raw materials |
|