| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Ethyl 2-acetoxy-2-methylacetoacetate Basic information |
| Product Name: | Ethyl 2-acetoxy-2-methylacetoacetate | | Synonyms: | ETHYL 2-ACETYLLACTATE ACETATE;2-(Acetyloxy)-2-methyl-3-oxobutanoic acid ethyl ester;Ethyl 2-acetoxy-2-Methylacetoacetate 97%;Butanoic acid, 2-(acetyloxy)-2-methyl-3-oxo-, ethyl ester;Ethyl 2-acetoxy-2-methylacetoaceta;Ethyl 2-acetoxy-2-methyl-3-oxobutanoate;Ethyl 2-(acetyloxy)-2-methyl-3-oxobutanoate;Ethyl 2-acetoxy-2-methylacetoacetate | | CAS: | 25409-39-6 | | MF: | C9H14O5 | | MW: | 202.2 | | EINECS: | 246-951-7 | | Product Categories: | | | Mol File: | 25409-39-6.mol |  |
| | Ethyl 2-acetoxy-2-methylacetoacetate Chemical Properties |
| Boiling point | 80-84 °C/1 mmHg (lit.) | | density | 1.079 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.428(lit.) | | Fp | 219 °F | | form | liquid | | InChI | InChI=1S/C9H14O5/c1-5-13-8(12)9(4,6(2)10)14-7(3)11/h5H2,1-4H3 | | InChIKey | RHFWCEYBHLGCKH-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(OC(C)=O)(C)C(=O)C |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Ethyl 2-acetoxy-2-methylacetoacetate Usage And Synthesis |
| Uses | Ethyl 2-acetoxy-2-methylacetoacetate was used to prepare 2-acetolactate via hydrolysis with NaOH. It was also used in isolation and characterization of a novel thermophilic bacterium Geobacillus sp. for the production of acetoin and 2,3-butanediol. |
| | Ethyl 2-acetoxy-2-methylacetoacetate Preparation Products And Raw materials |
|