| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Pentacyclo[5.4.0(2,6).0(3,10).0(5,9)]undecane-8,11-dione Basic information |
| Product Name: | Pentacyclo[5.4.0(2,6).0(3,10).0(5,9)]undecane-8,11-dione | | Synonyms: | 6).0(3,10).0(5,9))-undecane-pentacyclo(5.4.0.0(;hexahydro-1,2,4-ethanylidene-1H-cyclobuta[cd]pentalene-5,7[1aH]-dione;Pentacyclo[5.4.0.0(2,6).0(3,10).0(5,9)]undecane-8,11-dione;pentacyclo(5.4.0.0(2,6).0(3,10).0(5,9))-undecane-;pentacycloundecanedione;WTUFOKOJVXNYTJ-MFAOOUEMSA-N;1,2,4-Ethanylylidene-1H-cyclobuta[cd]pentalene-5,7(1aH)-dione, hexahydro-;Hexahydro-1,2,4-ethanylylidene-1H-cyclobuta[cd]pentalene-5,7(1aH)-dione | | CAS: | 2958-72-7 | | MF: | C11H10O2 | | MW: | 174.2 | | EINECS: | | | Product Categories: | C11 to C12;Carbonyl Compounds;Ketones | | Mol File: | 2958-72-7.mol | ![Pentacyclo[5.4.0(2,6).0(3,10).0(5,9)]undecane-8,11-dione Structure](CAS/GIF/2958-72-7.gif) |
| | Pentacyclo[5.4.0(2,6).0(3,10).0(5,9)]undecane-8,11-dione Chemical Properties |
| Melting point | 240-242 °C(lit.) | | Boiling point | 265.17°C (rough estimate) | | density | 1.0844 (rough estimate) | | refractive index | 1.5250 (estimate) | | storage temp. | Store at 0-8 °C | | InChI | 1S/C11H10O2/c12-10-6-2-1-3-5-4(2)8(10)9(5)11(13)7(3)6/h2-9H,1H2/t2-,3+,4-,5+,6-,7-,8-,9-/m1/s1 | | InChIKey | WTUFOKOJVXNYTJ-MFAOOUEMSA-N | | SMILES | O=C1[C@H]2[C@@H]3C[C@H]4[C@H]5[C@@H]3[C@@H]1[C@H]5C(=O)[C@@H]24 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Pentacyclo[5.4.0(2,6).0(3,10).0(5,9)]undecane-8,11-dione Usage And Synthesis |
| Uses | Pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione was used in the synthesis of 8,11-dihydroxy-pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-lactam by reacting with aqueous sodium cyanide. |
| | Pentacyclo[5.4.0(2,6).0(3,10).0(5,9)]undecane-8,11-dione Preparation Products And Raw materials |
|