|
|
| | 3-Fluoro-2-methylaniline Basic information |
| | 3-Fluoro-2-methylaniline Chemical Properties |
| Melting point | 7 °C (lit.) | | Boiling point | 89-91 °C/15 mmHg (lit.) | | density | 1.099 g/mL at 25 °C (lit.) | | refractive index | 1.542-1.544 | | Fp | 86 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform, Methanol (Slightly) | | form | Oil | | pka | 3.44±0.10(Predicted) | | color | Pale Yellow to Dark Red | | Specific Gravity | 1.099 | | Stability: | Air Sensitive | | InChI | InChI=1S/C7H8FN/c1-5-6(8)3-2-4-7(5)9/h2-4H,9H2,1H3 | | InChIKey | SLDLVGFPFFLYBM-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(F)=C1C | | CAS DataBase Reference | 443-86-7(CAS DataBase Reference) |
| Hazard Codes | T,Xi,Xn | | Risk Statements | 36/37/38-23/24/25-20/21/22 | | Safety Statements | 45-36/37/39-26-36/37-36 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Toxic/Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214300 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Fluoro-2-methylaniline Usage And Synthesis |
| Chemical Properties | clear yellowish liquid | | Uses | 3-Fluoro-2-methylaniline was used in the synthesis of 2-amino-1,7,9-trimethylimidazo[4,5-g]quinoxaline. |
| | 3-Fluoro-2-methylaniline Preparation Products And Raw materials |
|