- 26-Difluorotoluene
-
- $1.00 / 1KG
-
2025-12-12
- CAS:443-84-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20000KG
- 2,6-Difluorotoluene
-
- $3.00 / 3KG
-
2019-07-06
- CAS:443-84-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | 2,6-Difluorotoluene Basic information |
| Product Name: | 2,6-Difluorotoluene | | Synonyms: | 2,6-DIFLUOROTOLUENE;2,6-Difluorotoluene 99%;2.6-Difluoro methyl benzene;2,6-Difluorotoluene,98%;2,6-Difluorotoluene,99%;Benzene, 1,3-difluoro-2-methyl-;2,6-Difluorotoluene>Cypermethrin Impurity 1 | | CAS: | 443-84-5 | | MF: | C7H6F2 | | MW: | 128.12 | | EINECS: | 623-587-0 | | Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Halogenated Hydrocarbons;Aromatic Hydrocarbons (substituted) & Derivatives;Halogen toluene;Miscellaneous;Aryl;C7 | | Mol File: | 443-84-5.mol |  |
| | 2,6-Difluorotoluene Chemical Properties |
| Boiling point | 112 °C/740 mmHg (lit.) | | density | 1.129 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.453(lit.) | | Fp | 50 °F | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.129 | | BRN | 1932656 | | InChI | InChI=1S/C7H6F2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 | | InChIKey | MZLSNIREOQCDED-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(F)=C1C | | CAS DataBase Reference | 443-84-5(CAS DataBase Reference) |
| Hazard Codes | F,F+ | | Risk Statements | 11 | | Safety Statements | 16-29-33 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | 2,6-Difluorotoluene Usage And Synthesis |
| Chemical Properties | colorless to light yellow liqui | | Uses | 2,6-Difluorotoluene was used to generate jet-cooled 2,6-difluorobenzyl radical and to investigate its vibronically resolved emission spectra. | | General Description | 2,6-Difluorotoluene reacts with chlorine to give 2,6-difluorobenzyl chloride, which gets converted to 2,6-difluorobenzaldehyde through Sommelet′s reaction. Six-fold potential for internal methyl rotation in first singlet excited state and cation ground state of 2,6-difluorotoluene has been determined. |
| | 2,6-Difluorotoluene Preparation Products And Raw materials |
|