|
|
| | 1-Piperazinecarboxylic acid, 4-(4-piperidinylmethyl)-, 1,1-dimethylethyl ester Basic information |
| | 1-Piperazinecarboxylic acid, 4-(4-piperidinylmethyl)-, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 378.7±27.0 °C(Predicted) | | density | 1.042±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 10.61±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H29N3O2/c1-15(2,3)20-14(19)18-10-8-17(9-11-18)12-13-4-6-16-7-5-13/h13,16H,4-12H2,1-3H3 | | InChIKey | RBPAAJAFRFIUEJ-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCN(CC2CCNCC2)CC1 |
| | 1-Piperazinecarboxylic acid, 4-(4-piperidinylmethyl)-, 1,1-dimethylethyl ester Usage And Synthesis |
| | 1-Piperazinecarboxylic acid, 4-(4-piperidinylmethyl)-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|