| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(4-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | 4-(4-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester | | Synonyms: | 1-Boc-4-(4-Bromophenyl)piperazine;4-(4-Boc-Piperazino)-1-bromobenzene;t-Butyl 4-(4-Bromophenyl)piperazine-1-carboxylate;1-Piperazinecarboxylic acid, 4-(4-broMophenyl)-, 1,1-diMethylethyl ester;1-tert-Butoxycarbonyl-4-(4-broMophenyl)piperazine;tert-Butyl 4-(4-bromophenyl)piperazine-1-carboxylate, 1-(4-Bromophenyl)-4-(tert-butoxycarbonyl)piperazine;1-Boc-4-(4-Bromophenyl)piperazin;4-(4-bromophenyl)-1-piperazinecarboxylic acid tert-butyl ester | | CAS: | 352437-09-3 | | MF: | C15H21BrN2O2 | | MW: | 341.24 | | EINECS: | | | Product Categories: | Aryl;Organohalides;Heterocycles | | Mol File: | 352437-09-3.mol |  |
| | 4-(4-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester Chemical Properties |
| Melting point | 146.3-147.5 °C | | Boiling point | 424.7±40.0 °C(Predicted) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | Room temperature. | | pka | 2.83±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C15H21BrN2O2/c1-15(2,3)20-14(19)18-10-8-17(9-11-18)13-6-4-12(16)5-7-13/h4-7H,8-11H2,1-3H3 | | InChIKey | QKIPWYSRBGTXRG-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCN(C2=CC=C(Br)C=C2)CC1 |
| Hazard Codes | Xi | | HS Code | 2933599590 |
| | 4-(4-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| Uses | 1-BOC-4-(4-Bromophenyl)piperazine is a reagent used in the synthesis of dual Bcl-2/Bcl-xL inhibitors. |
| | 4-(4-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|