FMOC-(S)-ALPHA-METHYLVALINE manufacturers
|
| | FMOC-(S)-ALPHA-METHYLVALINE Basic information |
| | FMOC-(S)-ALPHA-METHYLVALINE Chemical Properties |
| Boiling point | 554.1±33.0 °C(Predicted) | | density | 1.209±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 4.02±0.16(Predicted) | | form | powder | | color | white | | InChI | InChI=1S/C21H23NO4/c1-13(2)21(3,19(23)24)22-20(25)26-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,13,18H,12H2,1-3H3,(H,22,25)(H,23,24)/t21-/m0/s1 | | InChIKey | AWEZXIRZNQCCNN-NRFANRHFSA-N | | SMILES | C(O)(=O)[C@](C)(C(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | FMOC-(S)-ALPHA-METHYLVALINE Usage And Synthesis |
| Uses | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2,3-dimethylbutanoic acid is a valine derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | FMOC-(S)-ALPHA-METHYLVALINE Preparation Products And Raw materials |
|