| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
6-(3-Pentenyl)-tetrahydro-2H-pyran-2-one manufacturers
|
| | 6-(3-Pentenyl)-tetrahydro-2H-pyran-2-one Basic information |
| Product Name: | 6-(3-Pentenyl)-tetrahydro-2H-pyran-2-one | | Synonyms: | tetrahydro-6-(3-pentenyl)-2H-pyran-2-one;JASMOLACTON;Tetrahydro-6-(3-pentenyl)-2H-pyran-2-on;6-(Pent-3-en-1-yl)oxan-2-one;8-DECEN-5-OLIDE;2H-Pyran-2-one, tetrahydro-6-(3-penten-1-yl)-;Jasmolactone >=95%;petal pyranone | | CAS: | 32764-98-0 | | MF: | C10H16O2 | | MW: | 168.23 | | EINECS: | 251-201-7 | | Product Categories: | | | Mol File: | 32764-98-0.mol |  |
| | 6-(3-Pentenyl)-tetrahydro-2H-pyran-2-one Chemical Properties |
| Boiling point | 149-151 °C(Press: 18 Torr) | | density | 0.962±0.06 g/cm3(Predicted) | | vapor pressure | 0.22Pa at 25℃ | | FEMA | 4441 | 8-DECEN-5-OLIDE | | Odor | at 100.00 %. oily fruity coconut floral petal absolute jasmin tuberose peach apricot | | Odor Type | oily | | biological source | synthetic | | Water Solubility | 5.69g/L at 20℃ | | JECFA Number | 1994 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C10H16O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h2-3,9H,4-8H2,1H3 | | InChIKey | NBCMACYORPIYNY-UHFFFAOYSA-N | | SMILES | C1(=O)OC(CCC=CC)CCC1 | | LogP | 2.3 at 35℃ | | EPA Substance Registry System | 2H-Pyran-2-one, tetrahydro-6-(3-pentenyl)- (32764-98-0) |
| WGK Germany | WGK 2 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | 6-(3-Pentenyl)-tetrahydro-2H-pyran-2-one Usage And Synthesis |
| Uses | flavors and fragrances | | Definition | ChEBI: Jasmolactone is a member of the class of 2-pyranones that is tetrahydro-2H-pyran-2-one substituted by a pent-2-en-5-yl group at position 6. It is used as a flavouring agent and as an ingredient in perfumes. It has a role as a flavouring agent, a fragrance and a plant metabolite. It is a member of 2-pyranones and an olefinic compound. | | Flammability and Explosibility | Non flammable |
| | 6-(3-Pentenyl)-tetrahydro-2H-pyran-2-one Preparation Products And Raw materials |
|