|
|
| | butyl diphenyl phosphate Basic information |
| Product Name: | butyl diphenyl phosphate | | Synonyms: | butyl diphenyl phosphate;Phosphoric acid, butyl diphenyl ester;phosphoric acid butyl ester diphenyl ester;Diphenylbutylphosphate | | CAS: | 2752-95-6 | | MF: | C16H19O4P | | MW: | 306.29 | | EINECS: | 220-398-1 | | Product Categories: | | | Mol File: | 2752-95-6.mol |  |
| | butyl diphenyl phosphate Chemical Properties |
| density | 1.0410 (rough estimate) | | refractive index | 1.4820 (estimate) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Water Solubility | <0.2g/L(25 ºC) | | InChI | InChI=1S/C16H19O4P/c1-2-3-14-18-21(17,19-15-10-6-4-7-11-15)20-16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3 | | InChIKey | DIBUFQMCUZYQKN-UHFFFAOYSA-N | | SMILES | P(OC1=CC=CC=C1)(OC1=CC=CC=C1)(OCCCC)=O | | EPA Substance Registry System | Butyl diphenyl phosphate (2752-95-6) |
| | butyl diphenyl phosphate Usage And Synthesis |
| Uses | Butyl Phenyl Phosphate is a phosphorus flame retardant additive. |
| | butyl diphenyl phosphate Preparation Products And Raw materials |
|