|
|
| | (+)-1-(tert-butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol Basic information |
| Product Name: | (+)-1-(tert-butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol | | Synonyms: | 2-Propanol, 1-[(1,1-dimethylethyl)amino]-3-[[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy]-, (2R)- (9CI);2-Propanol, 1-[(1,1-dimethylethyl)amino]-3-[[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy]-, (R)-;d-Timolol;L 714465;(2R)-1-(tert-Butylamino)-3-(4-morpholino-1,2,5-thiadiazole-3-yloxy)-2-propanol;(R)-1-(tert-Butylamino)-3-[[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy]-2-propanol;(R)-1-[(1,1-Dimethylethyl)amino]-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]-2-propanol;(R)-1-[(1,1-Dimethylethyl)amino]-3-[[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy]-2-propanol | | CAS: | 26839-76-9 | | MF: | C13H24N4O3S | | MW: | 316.41966 | | EINECS: | 248-033-1 | | Product Categories: | | | Mol File: | 26839-76-9.mol | ![(+)-1-(tert-butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol Structure](CAS/GIF/26839-76-9.gif) |
| | (+)-1-(tert-butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol Chemical Properties |
| solubility | Chloroform (Slightly), DMSO (Soluble), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Thick Oil | | color | Colourless to Yellow | | InChI | InChI=1S/C13H24N4O3S/c1-13(2,3)14-8-10(18)9-20-12-11(15-21-16-12)17-4-6-19-7-5-17/h10,14,18H,4-9H2,1-3H3 | | InChIKey | BLJRIMJGRPQVNF-UHFFFAOYSA-N | | SMILES | C(NC(C)(C)C)C(O)COC1C(N2CCOCC2)=NSN=1 |
| | (+)-1-(tert-butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol Usage And Synthesis |
| Chemical Properties | Oil | | Uses | (R)-Timolol is an antihypertensive agent that increases ocular blood flow and reduces intraocular pressure. (R)-Timolol is an β-adrenergic blocking agent that binds only to nonspecific sites in the pa
rticulate fraction of the heart, lungs, and brain. | | Uses | (R)-Timolol (Timolol EP Impurity A; Timolol BP Impurity A; Timolol USP Related Compound A) is an antihypertensive agent that increases ocular blood flow and reduces intraocular pressure. (R)-Timolol is an β-adrenergic blocking agent that binds only to nonspecific sites in the particulate fraction of the heart, lungs, and brain. | | Definition | ChEBI: (R)-timolol is the (R)-(+) (less active) enantiomer of timolol. It is an enantiomer of a (S)-timolol (anhydrous). |
| | (+)-1-(tert-butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol Preparation Products And Raw materials |
|