| Company Name: |
IGM RESINS |
| Tel: |
021-52080993 13917193189 |
| Email: |
selene.wu@igmresins.com |
|
| | (5-ethyl-1,3-dioxan-5-yl)methyl acrylate Basic information | | Uses |
| Product Name: | (5-ethyl-1,3-dioxan-5-yl)methyl acrylate | | Synonyms: | (5-ethyl-1,3-dioxan-5-yl)methyl acrylate;2-Propenoic acid, (5-ethyl-1,3-dioxan-5-yl)methyl ester;5-Ethyl-5-(acryloyloxymethyl)-1,3-dioxane;Acrylic acid (5-ethyl-1,3-dioxane-5-yl)methyl ester;Propenoic acid (5-ethyl-1,3-dioxan-5-yl)methyl ester;5-acryloxyMethyl-5-ethyl-1,3-dioxacyclohexane;(5-Ethyl-1,3-dioxan-5-yl)methyl Acrylate (stabilized with MEHQ);(5-ethyl-1,3-dioxan-5-yl)methyl prop-2-enoate | | CAS: | 66492-51-1 | | MF: | C10H16O4 | | MW: | 200.23 | | EINECS: | 266-380-7 | | Product Categories: | | | Mol File: | 66492-51-1.mol |  |
| | (5-ethyl-1,3-dioxan-5-yl)methyl acrylate Chemical Properties |
| Boiling point | 78°C/0.3mmHg(lit.) | | density | 1.033±0.06 g/cm3(Predicted) | | vapor pressure | 0.6Pa at 20℃ | | refractive index | 1.4620 to 1.4660 | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | 9.3g/L at 25℃ | | Stability: | Unstable; may be sold with an inhibitor added. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C10H16O4/c1-3-9(11)14-7-10(4-2)5-12-8-13-6-10/h3H,1,4-8H2,2H3 | | InChIKey | STGXUBIZGYMIRM-UHFFFAOYSA-N | | SMILES | C(OCC1(CC)COCOC1)(=O)C=C | | LogP | 1.9 at 23℃ | | EPA Substance Registry System | 2-Propenoic acid, (5-ethyl-1,3-dioxan-5-yl)methyl ester (66492-51-1) |
| RIDADR | UN 3082 9/PG III | | TSCA | TSCA listed | | HS Code | 2932.99.9090 | | HazardClass | 9 | | PackingGroup | III |
| | (5-ethyl-1,3-dioxan-5-yl)methyl acrylate Usage And Synthesis |
| Uses | Cyclotrimethylolpropane methyl acetal acrylate is a colorless or pale yellow transparent liquid. Literature reports that it can be used to prepare UV-curable coatings for optical fiber coatings and pure, tough resins for 3D printing. | | Description | (5-ethyl-1,3-dioxan-5-yl)methyl acrylate is a colorless or light yellow transparent liquid, and it has been reported in the literature that it can be used to prepare UV-curable coatings for optical fiber coatings and 3D printing pure transparent, tough resins. | | Chemical Properties | yellow liquid | | Flammability and Explosibility | Non flammable |
| | (5-ethyl-1,3-dioxan-5-yl)methyl acrylate Preparation Products And Raw materials |
|