| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
3-(benzoxazol-2-yl)-7-(diethylamino)-2-benzopyrone manufacturers
- EMI1
-
- $35.00
-
2026-08-21
- CAS:35773-42-3
- Purity: 99.96%
- Supply Ability: 10g
|
| | 3-(benzoxazol-2-yl)-7-(diethylamino)-2-benzopyrone Basic information |
| Product Name: | 3-(benzoxazol-2-yl)-7-(diethylamino)-2-benzopyrone | | Synonyms: | 2H-1-Benzopyran-2-one, 3-(2-benzoxazolyl)-7-(diethylamino)-;3-(Benzoxazol-2-yl)-7-diethylamino-2H-1-benzopyran-2-one;3-(Benzoxazole-2-yl)-7-(diethylamino)-2H-1-benzopyran-2-one;7-(Diethylamino)-3-(benzoxazole-2-yl)-2H-1-benzopyran-2-one;3-(1,3-benzoxazol-2-yl)-7-(diethylamino)-2H-chromen-2-one;3-(benzoxazol-2-yl)-7-(diethylamino)-2-benzopyrone;EMI1 (EGFR MaMTH Inhibitor 1);ChemBridge-5213777 | | CAS: | 35773-42-3 | | MF: | C20H18N2O3 | | MW: | 334.37 | | EINECS: | 252-721-7 | | Product Categories: | | | Mol File: | 35773-42-3.mol |  |
| | 3-(benzoxazol-2-yl)-7-(diethylamino)-2-benzopyrone Chemical Properties |
| Melting point | 185-186 °C(Solv: N,N-dimethylformamide (68-12-2)) | | Boiling point | 551.0±60.0 °C(Predicted) | | density | 1.284±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | form | Solid | | pka | 2.94±0.20(Predicted) | | color | Light yellow to yellow | | InChI | 1S/C20H18N2O3/c1-3-22(4-2)14-10-9-13-11-15(20(23)25-18(13)12-14)19-21-16-7-5-6-8-17(16)24-19/h5-12H,3-4H2,1-2H3 | | InChIKey | UJOQSHCJYVRZKJ-UHFFFAOYSA-N | | SMILES | N(CC)(CC)c1cc2[o][c](c(cc2cc1)c3nc4c([o]3)cccc4)=O | | EPA Substance Registry System | 2H-1-Benzopyran-2-one, 3-(2-benzoxazolyl)-7-(diethylamino)- (35773-42-3) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 3-(benzoxazol-2-yl)-7-(diethylamino)-2-benzopyrone Usage And Synthesis |
| Uses | EMI1 is an EGFR ex19del/T790M/C797S and EGFR L858R/T790M/C797S inhibitor. EMI1 can be used for the research of mutant EGFR-associated, drug-resistant non-small-cell lung cancer (NSCLC)[1]. | | Biological Activity | EMI1 (ChemBridge 5213777) is a call penetrant and potent inhibitor of EGFR signaling in EGFR L858R/T790M/C797S and ex19del/T790M/C797S triple mutants associated with drug-resistant NSCLC. Additionally, EMI1 potently depolymerized interphase microtubules, disrupts spindle formation and induced mitotic block in PC9 EGFR ex19del/T790M/C797S cells. EMI1 exhibits potent anti-proliferative activity against various cancer cell lines. | | IC 50 | EGFRdel19 T790M C797S; EGFRL858R/T790M/C797S | | References | [1] Punit Saraon, et al. A drug discovery platform to identify compounds that inhibit EGFR triple mutants. Nat Chem Biol. 2020 May;16(5):577-586. DOI:10.1038/s41589-020-0484-2 |
| | 3-(benzoxazol-2-yl)-7-(diethylamino)-2-benzopyrone Preparation Products And Raw materials |
|