| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | Polyaminopropyl biguanide Basic information |
| Product Name: | Polyaminopropyl biguanide | | Synonyms: | N-(3-Aminopropyl)imidodicarbonimidic diamide homopolymer;Imidodicarbonimidic diamide, N-(3-aminopropyl)-, homopolymer;POLYAMINE PROPYL BIGUANIDE;Polyaminopropyl biguanide, PAPB;Tianfu Chem POLYAMINOPROPYL BIGUANIDE 133029-32-0;N-(3-Aminopropyl)imidodicarbonimidic diamide;Polyaminopropyl biguanide（PHMB）;Polyaminopropyl biguanide | | CAS: | 133029-32-0 | | MF: | C5H14N6 | | MW: | 158.21 | | EINECS: | 205-516-1 | | Product Categories: | | | Mol File: | 133029-32-0.mol |  |
| | Polyaminopropyl biguanide Chemical Properties |
| Cosmetics Ingredients Functions | PRESERVATIVE | | InChI | InChI=1S/C5H14N6/c6-2-1-3-10-5(9)11-4(7)8/h1-3,6H2,(H6,7,8,9,10,11) | | InChIKey | XKFDVLUHBRJZQF-UHFFFAOYSA-N | | SMILES | N(CCCN)C(=N)NC(N)=N |
| | Polyaminopropyl biguanide Usage And Synthesis |
| Uses | Polyhexamethylene biguanide (PHMB) is an antiseptic with antiviral and antibacterial properties used in several ways including wound care dressings, contact lens cleaning solutions, perioperative cleansing products, and swimming pool cleaners. | | Definition | A
hydrochloride salt of polyhexamethylene biguanide. It is a broad
spectrum and fast acting bactericide which is used for the formulation
of disinfectants and sanitisers. | | Side effects | PHMB (polyaminopropyl biguanide) proved toxic to keratocytes and was shown to have acute toxic effects in human cells where it caused severe inflammation, atherogenesis, and aging. | | Safety | Polyaminopropyl Biguanide (PHMB) is not safe for consumers when used as a preservative in all cosmetic products up to the maximum concentration of 0.3%. The safe use could be based on a lower use concentration and/or restrictions with regard to cosmetic products' categories. |
| | Polyaminopropyl biguanide Preparation Products And Raw materials |
|