| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Ruthenium acetate
-
- $2.00
-
2026-08-25
- CAS:72196-32-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- Ruthenium acetate
-
-
2025-12-24
- CAS:72196-32-8
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000 tons
- Ruthenium acetate
-
- $6.60
-
2019-12-24
- CAS:72196-32-8
- Min. Order: 500g
- Purity: 98%
- Supply Ability: 500g, 1kg, 50kg,100kg
|
| | Ruthenium acetate Basic information |
| Product Name: | Ruthenium acetate | | Synonyms: | Ruthenium triacetate;Acetic Acid, 2 N Solution, USP VoluMetric Solution;Hexa(acetato)-u-oxotris(aqua)trirutheniuM(III) acetate;ACETIC ACID (1,2-13C2, 99%);Acetic acid,ruthenium(3+) salt (9CI);RUTHENIUM ACETATE;ruthenium(3+),triacetate;Acetic acid, ruthenium(3+) salt | | CAS: | 72196-32-8 | | MF: | C2H4O2Ru | | MW: | 161.12 | | EINECS: | | | Product Categories: | chemical reaction,pharm,electronic,materials | | Mol File: | 72196-32-8.mol |  |
| | Ruthenium acetate Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | Brown to black Solid | | InChI | InChI=1S/C2H4O2.Ru/c1-2(3)4;/h1H3,(H,3,4); | | InChIKey | SPDCFZAAMSXKTK-UHFFFAOYSA-N | | SMILES | C(=O)(O)C.[Ru] |
| | Ruthenium acetate Usage And Synthesis |
| Description | Ruthenium Acetate is a moderately water-soluble crystalline Ruthenium source that decomposes to Ruthenium oxide on heating. Ruthenium Acetate is a coordination compound. It consists of three ruthenium atoms connected by acetate ligands. This compound is known for its applications in catalysis, particularly in organic synthesis reactions such as hydrogenation, carbonylation, and oxidation processes. Ruthenium acetate can also be used to prepare other ruthenium complexes and materials. | | Preparation |
Ruthenium acetate is prepared by heating ruthenium trichloride in acetic acid in the presence of sodium acetate.
| | Chemical Reactivity | Ruthenium acetate reacts with many ligands such as triphenylphosphine and pyridine concomitant with reduction.
|
| | Ruthenium acetate Preparation Products And Raw materials |
|