|
|
| | 3,5,7-Trimethyladamantane-1-carboxylic acid Basic information |
| Product Name: | 3,5,7-Trimethyladamantane-1-carboxylic acid | | Synonyms: | tricyclo[3.3.1.1~3,7~]decane-1-carboxylic acid, 3,5,7-trim;AKOS BBS-00006252;AKOS BC-0553;Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3,5,7-trimethyl-;3,5,7-Trimethyladamantane-1-carboxylic acid | | CAS: | 15291-66-4 | | MF: | C14H22O2 | | MW: | 222.32 | | EINECS: | | | Product Categories: | Adamantane derivatives | | Mol File: | 15291-66-4.mol |  |
| | 3,5,7-Trimethyladamantane-1-carboxylic acid Chemical Properties |
| Melting point | 139-141 °C(Solv: ethanol (64-17-5); water (7732-18-5)) | | Boiling point | 334.8±10.0 °C(Predicted) | | density | 1.165±0.06 g/cm3(Predicted) | | pka | 4.89±0.70(Predicted) | | form | solid | | InChI | 1S/C14H22O2/c1-11-4-12(2)6-13(3,5-11)9-14(7-11,8-12)10(15)16/h4-9H2,1-3H3,(H,15,16)/t11-,12+,13-,14- | | InChIKey | DHIIUPVOLLOORM-YXSUXZIUSA-N | | SMILES | OC(C1(C[C@]23C)C[C@](C2)(C)C[C@](C3)(C)C1)=O |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3,5,7-Trimethyladamantane-1-carboxylic acid Usage And Synthesis |
| | 3,5,7-Trimethyladamantane-1-carboxylic acid Preparation Products And Raw materials |
|