| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dichloro(2,6,10-dodecatriene-1,12-diyl)ruthenium(IV) Basic information | | Reaction |
| Product Name: | Dichloro(2,6,10-dodecatriene-1,12-diyl)ruthenium(IV) | | Synonyms: | Dichloro(2,6,10-dodecatriene-1,12-diyl)ruthenium(IV),99%;dichlororuthenium(2+):(2E,6Z,10E)-dodeca-2,6,10-triene;Dichloro((1,2,3,6,7,10,11,12-ETA)-2,6,10-dodecatriene-1,12-diyl)-ruthenium;Dichloro[(2,6,10-dodecatriene)-1,12-diyl]ruthenium(IV), CAS 12170-97-7;Dichloro(2,6,10-dodecatriene-1,12-diyl)ruthenium(IV) | | CAS: | 12170-97-7 | | MF: | C12H18Cl2Ru | | MW: | 334.25 | | EINECS: | | | Product Categories: | organometallic complex | | Mol File: | 12170-97-7.mol |  |
| | Dichloro(2,6,10-dodecatriene-1,12-diyl)ruthenium(IV) Chemical Properties |
| Melting point | 192°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | orange | | InChI | 1S/C12H18.2ClH.Ru/c1-3-5-7-9-11-12-10-8-6-4-2;;;/h3-6,11-12H,1-2,7-10H2;2*1H;/q;;;+2/p-2/b5-3+,6-4+,12-11-;;; | | InChIKey | RSRAKQPWMXANGM-LXALEWKWSA-L | | SMILES | Cl[Ru]1(Cl)C\C=C\CCC=CCC\C=C\C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Dichloro(2,6,10-dodecatriene-1,12-diyl)ruthenium(IV) Usage And Synthesis |
| Reaction |
- An efficient catalyst used for the isomerization of allylic alcohols into carbonyl compounds in organic or aqueous media.
- An efficient catalyst used for the deprotection of N-allylic amines.
| | Uses | Catalyst for:
- Redox isomerization/transfer hydrogenation
- Deprotection of N-allyl amides and lactams
- Isomerization of allylamines
- Isomerization of allylic alcohols into carbonyl compounds
| | reaction suitability | core: ruthenium
reagent type: catalyst |
| | Dichloro(2,6,10-dodecatriene-1,12-diyl)ruthenium(IV) Preparation Products And Raw materials |
|