| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Butyl (S)-(-)-2-pyrrolidone-5-carboxylate manufacturers
|
| | Butyl (S)-(-)-2-pyrrolidone-5-carboxylate Basic information |
| Product Name: | Butyl (S)-(-)-2-pyrrolidone-5-carboxylate | | Synonyms: | BUTYL L-PYROGLUTAMATE;Butyl PyroglutaMate;butyl 5-oxo-L-prolinate;(S)-5-Oxo-2α-pyrrolidinecarboxylic acid butyl ester;5-Oxo-L-proline butyl ester;Einecs 225-568-9;L-Proline, 5-oxo-, butyl ester;Butyl (S)-5-oxopyrrolidine-2-carboxylate | | CAS: | 4931-68-4 | | MF: | C9H15NO3 | | MW: | 185.22 | | EINECS: | 225-568-9 | | Product Categories: | | | Mol File: | 4931-68-4.mol |  |
| | Butyl (S)-(-)-2-pyrrolidone-5-carboxylate Chemical Properties |
| Boiling point | 180 °C/6.5 mmHg (lit.) | | density | 1.104 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.403(lit.) | | Fp | >230 °F | | solubility | Chloroform | | form | Oil | | pka | 14+-.0.40(Predicted) | | color | Yellow | | Optical Rotation | [α]20/D 13°, neat | | InChI | 1S/C9H15NO3/c1-2-3-6-13-9(12)7-4-5-8(11)10-7/h7H,2-6H2,1H3,(H,10,11)/t7-/m0/s1 | | InChIKey | QBBAJUQOYIURHA-ZETCQYMHSA-N | | SMILES | CCCCOC(=O)[C@@H]1CCC(=O)N1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids not in Storage Class 3 | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Butyl (S)-(-)-2-pyrrolidone-5-carboxylate Usage And Synthesis |
| Uses | Butyl Pyroglutamate is an derivative of L-Glutamic Acid (G596960), an important neurotransmitter that plays a key role in long-term potentiation and is important for learning and memory. |
| | Butyl (S)-(-)-2-pyrrolidone-5-carboxylate Preparation Products And Raw materials |
|