| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Accela ChemBio Inc. |
| Tel: |
+1-858-6993322 +86-18019713315 |
| Email: |
info@accelachem.com |
|
| | AKOS BBS-00005954 Basic information |
| Product Name: | AKOS BBS-00005954 | | Synonyms: | AKOS BBS-00005954;5-(4-ETHOXYPHENYL)-3-ISOXAZOLECARBOXYLIC ACID;UKRORGSYN-BB BBV-028648;5-(4-ethoxyphenyl)-1,2-oxazole-3-carboxylic acid;3-Isoxazolecarboxylic acid, 5-(4-ethoxyphenyl)- | | CAS: | 887360-48-7 | | MF: | C12H11NO4 | | MW: | 233.22 | | EINECS: | | | Product Categories: | | | Mol File: | 887360-48-7.mol |  |
| | AKOS BBS-00005954 Chemical Properties |
| Boiling point | 463.8±40.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | pka | 3.34±0.10(Predicted) | | form | solid | | InChI | 1S/C12H11NO4/c1-2-16-9-5-3-8(4-6-9)11-7-10(12(14)15)13-17-11/h3-7H,2H2,1H3,(H,14,15) | | InChIKey | FTVWKNMSWDXJCY-UHFFFAOYSA-N | | SMILES | O=C(O)C1=NOC(C2=CC=C(OCC)C=C2)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | AKOS BBS-00005954 Usage And Synthesis |
| | AKOS BBS-00005954 Preparation Products And Raw materials |
|