|
|
| | 2-Fluoro-3-methylaniline Basic information |
| | 2-Fluoro-3-methylaniline Chemical Properties |
| Boiling point | 87 °C / 12mmHg | | density | 1.11 | | refractive index | 1.5360 | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | liquid | | pka | 3.33±0.10(Predicted) | | color | clear, very dark red | | InChI | InChI=1S/C7H8FN/c1-5-3-2-4-6(9)7(5)8/h2-4H,9H2,1H3 | | InChIKey | WFZUBZAEFXETBF-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(C)=C1F | | CAS DataBase Reference | 1978-33-2(CAS DataBase Reference) |
| | 2-Fluoro-3-methylaniline Usage And Synthesis |
| | 2-Fluoro-3-methylaniline Preparation Products And Raw materials |
|