| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
- Emivirine
-
- $30.00
-
2026-07-27
- CAS:149950-60-7
- Purity: 99.80%
- Supply Ability: 10g
|
| | emivirine Basic information |
| Product Name: | emivirine | | Synonyms: | emivirine;6-benzyl-1-(ethoxymethyl)-5-isopropyluracil;MKC 442;2,4(1H,3H)-Pyrimidinedione, 1-(ethoxymethyl)-5-(1-methylethyl)-6-(phenylmethyl)-;1-(Ethoxymethyl)-6-benzyl-5-isopropyluracil;DRG 0302;DRG0302;DRG-0302 | | CAS: | 149950-60-7 | | MF: | C17H22N2O3 | | MW: | 302.37 | | EINECS: | | | Product Categories: | | | Mol File: | 149950-60-7.mol |  |
| | emivirine Chemical Properties |
| Melting point | 109.1-110.7 °C(Solv: ethanol (64-17-5); water (7732-18-5)) | | density | 1.133±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | pka | 9.46±0.40(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C17H22N2O3/c1-4-22-11-19-14(10-13-8-6-5-7-9-13)15(12(2)3)16(20)18-17(19)21/h5-9,12H,4,10-11H2,1-3H3,(H,18,20,21) | | InChIKey | MLILORUFDVLTSP-UHFFFAOYSA-N | | SMILES | C1(=O)N(COCC)C(CC2=CC=CC=C2)=C(C(C)C)C(=O)N1 |
| | emivirine Usage And Synthesis |
| Uses | Treatment
of HIV-1 infections (non-nucleoside reverse
transcriptase inhibitor). | | Uses | Emivirine can be used to treat disease cause by SARS-CoV-2 | | Definition | ChEBI: A pyrimidone that is uracil which is substituted at positions 1, 5 and 6 by ethoxymethyl, isopropyl, and benzyl groups, respectively. A non-nucleoside inhibitor of HIV-1 reverse transcriptase, emivirine was an unsuccessful experimental agent for the treatm
nt of HIV. | | Brand name | Coactinon (Mitsubishi Chemical
Corporation, Japan). | | Hazard | Moderately toxic by ingestion. | | Safety Profile | Moderately toxic by
ingestion. When heated to decomposition it
emits toxic vapors of NOx. |
| | emivirine Preparation Products And Raw materials |
|