prothioconazole-desthio manufacturers
|
| | prothioconazole-desthio Basic information |
| Product Name: | prothioconazole-desthio | | Synonyms: | Prothioconazole-desthio, 10 μg /μL in acetonitrile;2-(1-CHLOROCYCLOPROPYL)-1-(2-CHLOROPHENYL)-3-(1,2,4-TRIAZOL-1-YL)-PROPAN-2-OL;Prothioconazole-desthio
Solution, 1000ppm;1H-1,2,4-Triazole-1-ethanol,a-(1-chlorocyclopropyl)-a-[(2-chlorophenyl)methyl]-;Prothioconazole Impurity 5;1H-1,2,4-Triazole-1-ethanol, α-(1-chlorocyclopropyl)-α-[(2-chlorophenyl)methyl]-;Prothioconazole-desthio Solution in Acetonitrile, 100μg/mL;2-(1-Chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propan-2-ol | | CAS: | 120983-64-4 | | MF: | C14H15Cl2N3O | | MW: | 312.19 | | EINECS: | | | Product Categories: | | | Mol File: | 120983-64-4.mol |  |
| | prothioconazole-desthio Chemical Properties |
| Melting point | 108 °C | | Boiling point | 508.2±60.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 13.25±0.29(Predicted) | | Appearance | White to off-white Solid | | BRN | 13200866 | | Major Application | agriculture
environmental | | InChI | InChI=1S/C14H15Cl2N3O/c15-12-4-2-1-3-11(12)7-14(20,13(16)5-6-13)8-19-10-17-9-18-19/h1-4,9-10,20H,5-8H2 | | InChIKey | HHUQPWODPBDTLI-UHFFFAOYSA-N | | SMILES | N1(CC(C2(Cl)CC2)(CC2=CC=CC=C2Cl)O)C=NC=N1 | | EPA Substance Registry System | 1H-1,2,4-Triazole-1-ethanol, .alpha.-(1-chlorocyclopropyl)-.alpha.-[(2-chlorophenyl)methyl]- (120983-64-4) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Repr. 2 |
| | prothioconazole-desthio Usage And Synthesis |
| Uses | 3-Des-(triazolothiono) 3-(1,2,4-Thiazol-1-yl) Prothioconazole is derived from Prothioconazole (P838830), which is an antifungal metabolite used in agricultural fungicides and herbicides. | | Definition | ChEBI: Prothioconazole-desthio is an organochlorine compound. |
| | prothioconazole-desthio Preparation Products And Raw materials |
|