| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Thiophen-2-yl-piperazine-1-carboxylic acid ethyl ester Basic information |
| Product Name: | 3-Thiophen-2-yl-piperazine-1-carboxylic acid ethyl ester | | Synonyms: | 3-Thien-2-yl-piperazine-1-carboxylic acid ethyl ester;Ethyl 3-thien-2-yl-piperazine-1-carboxylate;3-Thiophen-2-yl-piperazine-1-carboxylic acid ethyl ester, 95+%;ethyl 3-thiophen-2-ylpiperazine-1-carboxylate;Ethyl 3-(2-thienyl)piperazine-1-carboxylate, 95%;1-Piperazinecarboxylic acid, 3-(2-thienyl)-, ethyl ester;Ethyl 3-(2-thienyl)-1-piperazinecarboxylate;3-Thiophen-2-yl-piperazine-1-carboxylic acid ethyl ester | | CAS: | 85803-50-5 | | MF: | C11H16N2O2S | | MW: | 240.32 | | EINECS: | | | Product Categories: | | | Mol File: | 85803-50-5.mol |  |
| | 3-Thiophen-2-yl-piperazine-1-carboxylic acid ethyl ester Chemical Properties |
| refractive index | 1.5485 | | form | solid | | InChI | 1S/C11H16N2O2S/c1-2-15-11(14)13-6-5-12-9(8-13)10-4-3-7-16-10/h3-4,7,9,12H,2,5-6,8H2,1H3 | | InChIKey | YNIWHEQLSSKQCX-UHFFFAOYSA-N | | SMILES | [s]1c(ccc1)C2NCCN(C2)C(=O)OCC |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids |
| | 3-Thiophen-2-yl-piperazine-1-carboxylic acid ethyl ester Usage And Synthesis |
| | 3-Thiophen-2-yl-piperazine-1-carboxylic acid ethyl ester Preparation Products And Raw materials |
|