- Kushenol F
-
-
2023-02-24
- CAS:97938-30-2
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- vexibinol
-
- $7.00
-
2020-02-19
- CAS:97938-30-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | vexibinol Basic information |
| Product Name: | vexibinol | | Synonyms: | vexibinol;(S)-2,3-Dihydro-5,7-dihydroxy-2-(2,4-dihydroxyphenyl)-6-[(R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-4H-1-benzopyran-4-one;(2S)-5,7-Dihydroxy-2,3-dihydro-2α-(2,4-dihydroxyphenyl)-8-[(R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-4H-1-benzopyran-4-one;4H-1-Benzopyran-4-one,2-(2,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-,(2S)-;Sophoraavanone G;(2S)-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one;Sophoraflavanone G,Inhibitor,anti-infammatory,HL60,inhibit,Apoptosis;(S)-2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-8-((R)-5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl)chroman-4-one | | CAS: | 97938-30-2 | | MF: | C25H28O6 | | MW: | 424.49 | | EINECS: | | | Product Categories: | | | Mol File: | 97938-30-2.mol |  |
| | vexibinol Chemical Properties |
| Melting point | 173-175℃ | | Boiling point | 659.3±55.0 °C(Predicted) | | density | 1.266±0.06 g/cm | | storage temp. | Store at -20°C | | solubility | Soluble in methanol; | | form | powder | | pka | 7.66±0.40(Predicted) | | color | White-yellowish | | Water Solubility | sparingly soluble in water | | Stability: | Light Sensitive | | Major Application | food and beverages | | InChIKey | XRYVAQQLDYTHCL-CMJOXMDJSA-N | | SMILES | O1[C@@H](CC(=O)c3c1c(c(cc3O)O)C[C@@H](CC=C(C)C)C(=C)C)c2c(cc(cc2)O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | vexibinol Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents. | | Uses | Sophoraflavanone G is a flavonoids of Sophora flavescens Ait. which exhibits antibacterial activity. Also, it is reported to exhibits anti-inflammatory activity. | | Definition | ChEBI: A tetrahydroxyflavanone having a structure of naringenin bearing an additional hydroxyl substituent at position 2' as well as a (2R)-5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl (lavandulyl) substituent at position 8'. |
| | vexibinol Preparation Products And Raw materials |
|