| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(-)-N-(3,5-Dinitrobenzoyl)-alpha-phenylethylamine Basic information |
| | (R)-(-)-N-(3,5-Dinitrobenzoyl)-alpha-phenylethylamine Chemical Properties |
| Melting point | 158-161 °C(lit.) | | Boiling point | 482.9±45.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | solubility | almost transparency in Acetone | | pka | 12.27±0.46(Predicted) | | form | Crystalline | | color | Off-white to pale yellow | | Optical Rotation | [α]18/D 46°, c = 0.9 in acetone | | BRN | 4268701 | | InChI | 1S/C15H13N3O5/c1-10(11-5-3-2-4-6-11)16-15(19)12-7-13(17(20)21)9-14(8-12)18(22)23/h2-10H,1H3,(H,16,19)/t10-/m1/s1 | | InChIKey | ABEVDCGKLRIYRW-SNVBAGLBSA-N | | SMILES | C[C@@H](NC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O)c2ccccc2 | | CAS DataBase Reference | 69632-32-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2924.21.4500 | | Storage Class | 11 - Combustible Solids |
| | (R)-(-)-N-(3,5-Dinitrobenzoyl)-alpha-phenylethylamine Usage And Synthesis |
| Uses | NMR chiral shift reagent | | Uses | (R)-()-3,5-Dinitro-N-(1-phenylethyl)benzamide may be used as a standard for determining its standard molar enthalpy of combustion and formation using an isoperibolic micro-combustion calorimeter. | | General Description | (R)-()-3,5-Dinitro-N-(1-phenylethyl)benzamide is a chiral derivatizating agent, which is employed for derivatizing enantiomers into diastereoisomers. It is an organic compound, which can effectively inhibit the replications of the Hepatitis C virus (HCV) and other viral infections. |
| | (R)-(-)-N-(3,5-Dinitrobenzoyl)-alpha-phenylethylamine Preparation Products And Raw materials |
|