|
|
| | 2,6-Bis(1,1-dimethylethyl)-4-(phenylmethylene)-2,5-cyclohexadien-1-one Basic information |
| Product Name: | 2,6-Bis(1,1-dimethylethyl)-4-(phenylmethylene)-2,5-cyclohexadien-1-one | | Synonyms: | PROSTAB6007;2,5-Cyclohexadien-1-one, 2,6-bis(1,1-dimethylethyl)-4-(phenylmethylene)-;2,6-bis(i,i-dimethyethyl)-4-(phenylmethylone)-2,5-cyclohexadiene-i-0ne;4-benzylidene-2,6-ditert-butylcyclohexa-2,5-dien-1-one;2,6-di-tert-butyl-4-benzylidene-cyclohexa-2,5-dienone;2,5-Cyclohexadien-1-one,4-benzylidene-2,6-di-tert-butyl- (7CI,8CI);4-Benzylidene-2,6-di-tert-butyl-2,5-cyclohexadien-1-one;Polymerisation inhibitor | | CAS: | 7078-98-0 | | MF: | C21H26O | | MW: | 294.43 | | EINECS: | 429-460-4 | | Product Categories: | | | Mol File: | 7078-98-0.mol |  |
| | 2,6-Bis(1,1-dimethylethyl)-4-(phenylmethylene)-2,5-cyclohexadien-1-one Chemical Properties |
| Melting point | 74-75 °C | | Boiling point | 186 °C(Press: 1 Torr) | | density | 1.030±0.06 g/cm3(Predicted) | | vapor pressure | 0.007Pa at 20℃ | | storage temp. | Storage temp. 2-8°C | | Appearance | Yellow to orange Solid | | Water Solubility | 5μg/L at 20℃ | | InChI | InChI=1S/C21H26O/c1-20(2,3)17-13-16(12-15-10-8-7-9-11-15)14-18(19(17)22)21(4,5)6/h7-14H,1-6H3 | | InChIKey | HCUWXYBKPSKTAB-UHFFFAOYSA-N | | SMILES | C1(=O)C(C(C)(C)C)=C/C(=C\C2=CC=CC=C2)/C=C1C(C)(C)C | | LogP | 6 at 20℃ | | EPA Substance Registry System | 2,5-Cyclohexadien-1-one, 2,6-bis(1,1-dimethylethyl)-4-(phenylmethylene)- (7078-98-0) |
| | 2,6-Bis(1,1-dimethylethyl)-4-(phenylmethylene)-2,5-cyclohexadien-1-one Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | 2,6-Bis(1,1-dimethylethyl)-4-(phenylmethylene)-2,5-cyclohexadien-1-one Preparation Products And Raw materials |
|