| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:beta-Zearalanol solution CAS:42422-68-4 Purity:10 mug/mL in acetonitrile, analytical standard Package:1ML Remarks:35407-1ML
|
|
| | BETA-ZEARALANOL Basic information |
| Product Name: | BETA-ZEARALANOL | | Synonyms: | taleranol;BETA-ZEARALANOL;2,4-DIHYDROXY-6-[6BETA,10-DIHYDROXY-UNDECYL)BENZOIC ACID MICRO-LACTONE;Taleranol (β-Zearalanol);B-zearalanol;BETAZERANOL;(3S,7S)-3,4,5,6,7,8,9,10,11,12-Decahydro-7,14,16-trihydroxy-3-methyl-1H-2-benzoxacyclotetradecin-1-one;(4S)-4β-Methyl-8β,16,18-trihydroxy-3-oxabicyclo[12.4.0]octadecane-1(14),15,17-triene-2-one | | CAS: | 42422-68-4 | | MF: | C18H26O5 | | MW: | 322.4 | | EINECS: | 636-982-8 | | Product Categories: | Heterpocycles;Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 42422-68-4.mol |  |
| | BETA-ZEARALANOL Chemical Properties |
| Melting point | 134-137°C | | Boiling point | 576.0±50.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | Fp | 2℃ | | storage temp. | 2-8°C | | solubility | Methanol: 10 mg/ml | | pka | 8.08±0.60(Predicted) | | form | A solid | | color | White to off-white | | BRN | 4844761 | | InChI | 1S/C18H26O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,14,19-21H,2-9H2,1H3/t12-,14-/m0/s1 | | InChIKey | DWTTZBARDOXEAM-JSGCOSHPSA-N | | SMILES | C[C@H]1CCC[C@@H](O)CCCCCc2cc(O)cc(O)c2C(=O)O1 |
| | BETA-ZEARALANOL Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | β-Zearalanol is a minor analogue of the zearalenone family of resorcinyl macrocyclic lactones, produced by several species of Fusarium. Like the other zearalenones, β-zearalanol exhibits estrogenic activity in animals. β-Zearalanol was investigated as a growth promotant for animals but did not advance to commercialisation. | | Uses | Animal growth promotant. Anabolic.
Controlled substance. | | Definition | ChEBI: Beta-Zearalanol is a macrolide. |
| | BETA-ZEARALANOL Preparation Products And Raw materials |
|