| Company Name: |
Heterochem |
| Tel: |
027-88041443 13072715837 |
| Email: |
sales@hetero-chem.com |
|
| | Methyl (S)-2-hydroxybutyrate Basic information |
| | Methyl (S)-2-hydroxybutyrate Chemical Properties |
| Boiling point | 159.3±8.0 °C(Predicted) | | density | 1.050±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 13.07±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H10O3/c1-3-4(6)5(7)8-2/h4,6H,3H2,1-2H3/t4-/m0/s1 | | InChIKey | DDMCDMDOHABRHD-BYPYZUCNSA-N | | SMILES | C(OC)(=O)[C@@H](O)CC |
| | Methyl (S)-2-hydroxybutyrate Usage And Synthesis |
| | Methyl (S)-2-hydroxybutyrate Preparation Products And Raw materials |
|