| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Amino-4-mercaptobenzotrifluoride hydrochloride Basic information |
| | 3-Amino-4-mercaptobenzotrifluoride hydrochloride Chemical Properties |
| Melting point | 196-198 °C(lit.) | | density | 2.46 | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Sensitive | Hygroscopic | | BRN | 4273774 | | InChI | InChI=1S/C7H6F3NS.ClH/c8-7(9,10)4-1-2-6(12)5(11)3-4;/h1-3,12H,11H2;1H | | InChIKey | FIAGYDIJZOWVAB-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C1=CC=C(S)C(N)=C1.Cl | | CAS DataBase Reference | 4274-38-8(CAS DataBase Reference) |
| Hazard Codes | Xn,T | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | UN2811 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Amino-4-mercaptobenzotrifluoride hydrochloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2-Amino-4-(trifluoromethyl)benzenethiol hydrochloride may be used in the synthesis of 6-trifluoromethyl-4H-1,4-benzothiazines, via condensation and oxidative cyclization with β-di-carbonyl compounds. |
| | 3-Amino-4-mercaptobenzotrifluoride hydrochloride Preparation Products And Raw materials |
|