|
|
| | tert-Butyl 8-aza-bicyclo[3.2.1]octan-3-ylcarbamate Basic information |
| Product Name: | tert-Butyl 8-aza-bicyclo[3.2.1]octan-3-ylcarbamate | | Synonyms: | 3-(Boc-aMino)-8-azabicyclo[3.2.1]octane;tert-Butyl 8-azabicyclo[3.2.1]octan-3-ylcarbamate, >=97%;tert-Butyl 8-aza-bicyclo[3.2.1]octan-3-ylcarbamate;TERT-BUTYL 8-AZABICYCLO[3.2.1]OCT-3-YLCARBAMATE;Carbamic acid, N-8-azabicyclo[3.2.1]oct-3-yl-, 1,1-dimethylethyl ester;3-tert-butoxyaminodemethyltropane | | CAS: | 287114-25-4 | | MF: | C12H22N2O2 | | MW: | 226.32 | | EINECS: | | | Product Categories: | | | Mol File: | 287114-25-4.mol | ![tert-Butyl 8-aza-bicyclo[3.2.1]octan-3-ylcarbamate Structure](CAS/GIF/287114-25-4.gif) |
| | tert-Butyl 8-aza-bicyclo[3.2.1]octan-3-ylcarbamate Chemical Properties |
| Boiling point | 339.8±31.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 12.36±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H22N2O2/c1-12(2,3)16-11(15)14-10-6-8-4-5-9(7-10)13-8/h8-10,13H,4-7H2,1-3H3,(H,14,15) | | InChIKey | UUHPKKKRSZBQIG-UHFFFAOYSA-N | | SMILES | N(C1CC2CCC(N2)C1)C(=O)OC(C)(C)C |
| | tert-Butyl 8-aza-bicyclo[3.2.1]octan-3-ylcarbamate Usage And Synthesis |
| | tert-Butyl 8-aza-bicyclo[3.2.1]octan-3-ylcarbamate Preparation Products And Raw materials |
|