| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(Chloromethyl)-6-methylimidazo[1,2-a]pyridine hydrochloride Basic information |
| | 2-(Chloromethyl)-6-methylimidazo[1,2-a]pyridine hydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C9H9ClN2/c1-7-2-3-9-11-8(4-10)6-12(9)5-7/h2-3,5-6H,4H2,1H3 | | InChIKey | PLRNFKAZHXWINP-UHFFFAOYSA-N | | SMILES | ClCC1=CN(C=C(C)C=C2)C2=N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 2-(Chloromethyl)-6-methylimidazo[1,2-a]pyridine hydrochloride Usage And Synthesis |
| | 2-(Chloromethyl)-6-methylimidazo[1,2-a]pyridine hydrochloride Preparation Products And Raw materials |
|