| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 3,4,5-Trimethylaniline Basic information |
| Product Name: | 3,4,5-Trimethylaniline | | Synonyms: | 3,4,5-Trimethylbenzenamine;NSC 403297;3,4,5-Trimethylaniline 98%;Benzenamine, 3,4,5-trimethyl-;3,4,5-Trimethylaniline | | CAS: | 1639-31-2 | | MF: | C9H13N | | MW: | 135.21 | | EINECS: | 216-679-3 | | Product Categories: | | | Mol File: | 1639-31-2.mol |  |
| | 3,4,5-Trimethylaniline Chemical Properties |
| Melting point | 79-80℃ | | Boiling point | 133-135℃ (16 Torr) | | density | 0.962±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 5.28±0.10(Predicted) | | color | Grey | | InChI | InChI=1S/C9H13N/c1-6-4-9(10)5-7(2)8(6)3/h4-5H,10H2,1-3H3 | | InChIKey | BXCUMAUHMPSRPZ-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C)=C(C)C(C)=C1 |
| RIDADR | 2811 | | HazardClass | 6.1 | | PackingGroup | Ⅱ | | HS Code | 2921490090 |
| | 3,4,5-Trimethylaniline Usage And Synthesis |
| | 3,4,5-Trimethylaniline Preparation Products And Raw materials |
|