|
|
| | 1,1'-Bicyclohexyl, 4-ethenyl-4'-propyl-, (trans,trans)- Basic information |
| Product Name: | 1,1'-Bicyclohexyl, 4-ethenyl-4'-propyl-, (trans,trans)- | | Synonyms: | 1,1'-Bicyclohexyl, 4-ethenyl-4'-propyl-, (trans,trans)-;TRANS,TRANS-4-PROPYL-4''-VINYL-BICYCLOHEXYL;(trans,trans)-4-Ethenyl-4'-propyl-1,1'-bicyclohexyl;CC 3V;trans,trans-4-Ethenyl-4'-propyl-bicyclohexyl;(trans,trans)-4-Propyl-4'-vinyl-1,1'-bi(cyclohexane);trans,trans-4-Propyl-4'-vinylbicyclohexyl;trans,trans-4-Propyl-4'-vinylbicyclohexyl> | | CAS: | 116020-44-1 | | MF: | C17H30 | | MW: | 234.42 | | EINECS: | 601-409-2 | | Product Categories: | Electronic Chemicals | | Mol File: | 116020-44-1.mol |  |
| | 1,1'-Bicyclohexyl, 4-ethenyl-4'-propyl-, (trans,trans)- Chemical Properties |
| Melting point | 36.0 to 40.0 °C | | Boiling point | 307℃ | | density | 0.896 | | vapor pressure | 0.015-1.3Pa at 20-50℃ | | Fp | 130℃ | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | color | White to Almost white | | InChI | InChI=1S/C17H30/c1-3-5-15-8-12-17(13-9-15)16-10-6-14(4-2)7-11-16/h4,14-17H,2-3,5-13H2,1H3/t14-,15-,16-,17- | | InChIKey | KHDBEDDPFRHGCN-GARHLSDISA-N | | SMILES | [C@@H]1([C@@H]2CC[C@@H](CCC)CC2)CC[C@@H](C=C)CC1 | | LogP | 5.7 at 25℃ |
| | 1,1'-Bicyclohexyl, 4-ethenyl-4'-propyl-, (trans,trans)- Usage And Synthesis |
| | 1,1'-Bicyclohexyl, 4-ethenyl-4'-propyl-, (trans,trans)- Preparation Products And Raw materials |
|