|
|
| | trans,trans-4-Propenyl-4''-propyl-bicyclohexyl Basic information |
| Product Name: | trans,trans-4-Propenyl-4''-propyl-bicyclohexyl | | Synonyms: | 1,1'-Bicyclohexyl, 4-(1E)-1-propen-1-yl-4'-propyl-, (trans,trans)-;(trans,trans)-4-(1E)-1-Propen-1-yl-4'-propyl-1,1'-bicyclohexyl;CC 3V1;(1r,1's,4R,4'R)-4-((E)-prop-1-enyl)-4'-propylbi(cyclohexane);(trans,trans)-4-((E)-Prop-1-en-1-yl)-4'-propyl-1,1'-bi(cyclohexane);(E)-4-(prop-1-enyl)-4'- propylbi(cyclohexane);(trans,trans)-4-(Prop-1-en-1-yl)-4'-propyl-1,1'-bi(cyclohexane);(trans,trans)-4-(1E)-1-propenyl-4'-propyl-1,1'-Bicyclohexyl | | CAS: | 279246-65-0 | | MF: | C18H32 | | MW: | 248.45 | | EINECS: | 608-148-3 | | Product Categories: | OLED | | Mol File: | 279246-65-0.mol |  |
| | trans,trans-4-Propenyl-4''-propyl-bicyclohexyl Chemical Properties |
| Melting point | 43.0 to 47.0 °C | | Boiling point | 325.0±9.0 °C(Predicted) | | density | 0.898 | | vapor pressure | 0.07-3.8Pa at 20-50℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | color | White to Almost white | | InChI | InChI=1S/C18H32/c1-3-5-15-7-11-17(12-8-15)18-13-9-16(6-4-2)10-14-18/h3,5,15-18H,4,6-14H2,1-2H3/b5-3+/t15-,16-,17-,18- | | InChIKey | IASLDLGGHXYCEO-NWYLIVIOSA-N | | SMILES | [C@@H]1([C@@H]2CC[C@@H](CCC)CC2)CC[C@@H](/C=C/C)CC1 | | LogP | 6.4 at 25℃ |
| | trans,trans-4-Propenyl-4''-propyl-bicyclohexyl Usage And Synthesis |
| | trans,trans-4-Propenyl-4''-propyl-bicyclohexyl Preparation Products And Raw materials |
|