|
|
| | L-3-Chlorophenylglycine Basic information |
| Product Name: | L-3-Chlorophenylglycine | | Synonyms: | (S)-2-(3-Chlorophenyl)glycine;Benzeneacetic acid,α-aMino-3-chloro-,(S)-;(S)-alpha-Amino-3-chlorobenzeneacetic acid;(S)-2-Amino-2-(3-chlorophenyl)acetic acid;(2S)-2-Amino-2-(3-chlorophenyl)acetic acid;(2S)-2-amino-2-(3-chlorophenyl)aceticacid, >97%;(αS)-α-Amino-3-chlorobenzeneacetic acid;Benzeneacetic acid, α-amino-3-chloro-, (αS)- | | CAS: | 119565-00-3 | | MF: | C8H8ClNO2 | | MW: | 185.61 | | EINECS: | | | Product Categories: | | | Mol File: | 119565-00-3.mol |  |
| | L-3-Chlorophenylglycine Chemical Properties |
| Melting point | 232℃ | | Boiling point | 316.9±32.0 °C(Predicted) | | density | 1.392±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 1.76±0.10(Predicted) | | Appearance | White to off-white Powder | | InChI | InChI=1/C8H8ClNO2/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/s3 | | InChIKey | MGOUENCSVMAGSE-KPOCXSGKNA-N | | SMILES | N[C@@H](C1C=CC=C(Cl)C=1)C(=O)O |&1:1,r| |
| | L-3-Chlorophenylglycine Usage And Synthesis |
| | L-3-Chlorophenylglycine Preparation Products And Raw materials |
|