Tetraoctylammonium chloride manufacturers
|
| | Tetraoctylammonium chloride Basic information |
| | Tetraoctylammonium chloride Chemical Properties |
| Melting point | 50-54 °C | | form | crystal | | color | white | | BRN | 4169201 | | InChI | 1S/C32H68N.ClH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H/q+1;/p-1 | | InChIKey | SNNIPOQLGBPXPS-UHFFFAOYSA-M | | SMILES | [Cl-].CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tetraoctylammonium chloride Usage And Synthesis |
| Uses | Tetraoctylammonium chloride is used as a: - Cationic additive in the preparation of the polyaniline-based calcium selective electrode.
- Phase transfer catalyst in the Brust-Schiffrin synthesis of gold nanoparticles.
|
| | Tetraoctylammonium chloride Preparation Products And Raw materials |
|