- Cyclo(Gly-Gln)
-
- $32.00
-
2026-07-15
- CAS:52662-00-7
- Purity:
- Supply Ability: 10g
|
| | CYCLO(-GLY-GLN) Basic information |
| Product Name: | CYCLO(-GLY-GLN) | | Synonyms: | CYCLO(-GLY-GLN);CYCLO(GLY-L-GLN);(2S)-HEXAHYDRO-3,6-DIOXO-PYRAZINEPROPANAMIDE;Ring (Glycyl-L-Glutamyl);2-Piperazinepropanamide,3,6-dioxo-,(S)-(9CI);3-[(2S)-3,6-DIOXOPIPERAZIN-2-YL]PROPANAMIDE;Cyclo(Gly-L-Gln)≥ 98% (HPLC);(S)-3,6-Dioxo-2-piperazinepropanamide | | CAS: | 52662-00-7 | | MF: | C7H11N3O3 | | MW: | 185.18 | | EINECS: | | | Product Categories: | PIPERIDINE | | Mol File: | 52662-00-7.mol |  |
| | CYCLO(-GLY-GLN) Chemical Properties |
| Boiling point | 722.0±45.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 13.00±0.40(Predicted) | | form | Solid | | color | White to off-white | | Sequence | Cyclo(Gly-Gln) | | InChI | InChI=1S/C7H11N3O3/c8-5(11)2-1-4-7(13)9-3-6(12)10-4/h4H,1-3H2,(H2,8,11)(H,9,13)(H,10,12)/t4-/m0/s1 | | InChIKey | PWADXPITHGKDSY-BYPYZUCNSA-N | | SMILES | N1C(=O)CNC(=O)[C@@H]1CCC(N)=O |
| | CYCLO(-GLY-GLN) Usage And Synthesis |
| Chemical Properties | White crystal | | Uses | Cyclo(Gly-L-Gln) inhibits the cardiorespiratory depression produced by β-endorphin and morphine. |
| | CYCLO(-GLY-GLN) Preparation Products And Raw materials |
|