H-Gly-Gly-Phe-OH manufacturers
- H-GLY-GLY-PHE-OH
-
- $7.00
-
2020-02-19
- CAS: 6234-26-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | H-Gly-Gly-Phe-OH Basic information |
| Product Name: | H-Gly-Gly-Phe-OH | | Synonyms: | (S)-2-[(N-Glycylglycyl)amino]-3-phenylpropionic acid;Gly-Gly-L-Phe-OH;Gly-Gly-Phe-OH;GLYCYL-GLYCYL-L-PHENYLALANINE;Enkephalin (2-4);Human beta-endorphin-(2-4);Gly-Gly-Phe-OH≥ 95% (HPLC);L-Phenylalanine, glycylglycyl- | | CAS: | 6234-26-0 | | MF: | C13H17N3O4 | | MW: | 279.29 | | EINECS: | | | Product Categories: | ADCs Linkers | | Mol File: | 6234-26-0.mol |  |
| | H-Gly-Gly-Phe-OH Chemical Properties |
| Melting point | 228-230 °C (decomp) | | Boiling point | 647.1±55.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | pka | 3.47±0.10(Predicted) | | form | Solid | | InChI | InChI=1S/C13H17N3O4/c14-7-11(17)15-8-12(18)16-10(13(19)20)6-9-4-2-1-3-5-9/h1-5,10H,6-8,14H2,(H,15,17)(H,16,18)(H,19,20)/t10-/m0/s1 | | InChIKey | KAJAOGBVWCYGHZ-JTQLQIEISA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)NC(=O)CNC(=O)CN |
| | H-Gly-Gly-Phe-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | H-Gly-Gly-Phe-OH is a tripeptide linker that may be used in the creation of antibody drug conjugates (ADCs). The N-terminal of the glycine tripeptide is free to perform a variety of reactions such as couplings with carboxylic acids or NHS esters. | | Definition | ChEBI: A tripeptide composed of glycine, glycine and L-phenylalanine residues joined in sequence. |
| | H-Gly-Gly-Phe-OH Preparation Products And Raw materials |
|